Name | Formoterol fumarate dihydrate |
Synonyms | Unii-W34shf8J2k forMaMide fuMarate dihydrate Formoterol Fumarate (100 mg) Formoterol fumarate dihydrate (±)-(R,R)-N-[2-Hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formamidehemifumarate (R,R)-N-[2-Hydroxy-5-[1-Hydroxy-2-[[2-(4-Methoxyphenyl)-1-Methylethyl]Amino]Ethyl]Phenyl]Formamide Fumarate Dihydrate (r*,r*)-n-[2-hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formamide fumarate dihydrate (R*,R*)-N-[2-Hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formamide fumarate dihydrate |
CAS | 183814-30-4 |
InChI | InChI=1/C19H24N2O4.C4H4O4.2H2O/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22;5-3(6)1-2-4(7)8;;/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22);1-2H,(H,5,6)(H,7,8);2*1H2/b;2-1+;;/t13-,19+;;;/m1.../s1 |
InChIKey | RATSWNOMCHFQGJ-XODSYJLDSA-N |
Molecular Formula | 2(C19H24N2O4).C4H4O4.2(H2O) |
Molar Mass | 496.51 |
Melting Point | 116-120°C |
Boling Point | 603.2°C at 760 mmHg |
Flash Point | 318.6°C |
Solubility | DMSO: soluble20mg/mL |
Vapor Presure | 2.12E-15mmHg at 25°C |
Appearance | solid |
Color | white to off-white |
Storage Condition | 2-8°C |
UN IDs | UN 2811 6.1 / PGII |
WGK Germany | 3 |
HS Code | 29242990 |
use | formoterol fumarate dihydrate is used in the fields of foreign trade export, scientific research and chemical reagents. |